2-amino-N-(4-ethylphenyl)benzamide structure
|
Common Name | 2-amino-N-(4-ethylphenyl)benzamide | ||
|---|---|---|---|---|
| CAS Number | 60624-39-7 | Molecular Weight | 240.30000 | |
| Density | 1.181g/cm3 | Boiling Point | 338.8ºC at 760 mmHg | |
| Molecular Formula | C15H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 158.7ºC | |
| Name | 2-amino-N-(4-ethylphenyl)benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.181g/cm3 |
|---|---|
| Boiling Point | 338.8ºC at 760 mmHg |
| Molecular Formula | C15H16N2O |
| Molecular Weight | 240.30000 |
| Flash Point | 158.7ºC |
| Exact Mass | 240.12600 |
| PSA | 55.12000 |
| LogP | 3.73770 |
| Index of Refraction | 1.654 |
| InChIKey | VSRZMOHTAFADKL-UHFFFAOYSA-N |
| SMILES | CCc1ccc(NC(=O)c2ccccc2N)cc1 |
| HS Code | 2924299090 |
|---|
|
~83%
2-amino-N-(4-et... CAS#:60624-39-7 |
| Literature: Dabiri; Salehi; Mohammadi, Ali A.; Baghbanzadeh; Kozehgiry, Gh. Journal of Chemical Research, 2004 , # 8 p. 570 - 572 |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2-aminophenyl)-N-(4-ethylphenyl)carboxamide |
| 2-Amino-N-(4-ethyl-phenyl)-benzamide |