methyl 1-(1-phenylpropan-2-yl)-4-(N-propanoylanilino)piperidine-4-carboxylate structure
|
Common Name | methyl 1-(1-phenylpropan-2-yl)-4-(N-propanoylanilino)piperidine-4-carboxylate | ||
|---|---|---|---|---|
| CAS Number | 60645-02-5 | Molecular Weight | 408.53300 | |
| Density | 1.134g/cm3 | Boiling Point | 515.1ºC at 760 mmHg | |
| Molecular Formula | C25H32N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 265.3ºC | |
| Name | methyl 1-(1-phenylpropan-2-yl)-4-(N-propanoylanilino)piperidine-4-carboxylate |
|---|
| Density | 1.134g/cm3 |
|---|---|
| Boiling Point | 515.1ºC at 760 mmHg |
| Molecular Formula | C25H32N2O3 |
| Molecular Weight | 408.53300 |
| Flash Point | 265.3ºC |
| Exact Mass | 408.24100 |
| PSA | 49.85000 |
| LogP | 4.00630 |
| Index of Refraction | 1.575 |
| InChIKey | SIKUJMOJXPGHSR-UHFFFAOYSA-N |
| SMILES | CCC(=O)N(c1ccccc1)C1(C(=O)OC)CCN(C(C)Cc2ccccc2)CC1 |
| HS Code | 2933399090 |
|---|
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |