rac Pterosin B structure
|
Common Name | rac Pterosin B | ||
|---|---|---|---|---|
| CAS Number | 60657-37-6 | Molecular Weight | 218.29200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H18O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of rac Pterosin Brac Pterosin B is a potent and specific SIK3 signaling inhibitor that suppresses SIK3 downstream cascades by up-regulating the phosphorylation levels in the SIK3 C-terminal regulatory domain. |
| Name | rac Pterosin B |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H18O2 |
|---|---|
| Molecular Weight | 218.29200 |
| Exact Mass | 218.13100 |
| PSA | 37.30000 |
| LogP | 2.21310 |
| InChIKey | SJNCSXMTBXDZQA-UHFFFAOYSA-N |
| SMILES | Cc1cc2c(c(C)c1CCO)C(=O)C(C)C2 |
|
Name: Drug recovery in Wistar rat urine treated with (2S)-Pterosin at 100 mg/kg, po adminis...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3532826
|
|
Name: Drug recovery in Wistar rat urine assessed as retention time treated with (2S)-Pteros...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3532823
|
|
Name: Drug recovery in Wistar rat urine treated with (2S)-Pterosin at 100 mg/kg, po adminis...
Source: ChEMBL
Target: N/A
External Id: CHEMBL3532824
|
| 6-(2-Hydroxyethyl)-2,5,7-trimethyl-1-indanone |