Platicodoside C
Modify Date: 2026-07-25 18:32:45
Platicodoside C structure
|
Common Name | Platicodoside C | ||
|---|---|---|---|---|
| CAS Number | 60657-91-2 | Molecular Weight | 1255.3 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C58H94O29 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | Platicodoside C |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C58H94O29 |
|---|---|
| Molecular Weight | 1255.3 |
| InChIKey | BXBACSOISVARGE-UHFFFAOYSA-N |
| SMILES | CC1OC(OC2C(OC(=O)C34CCC(C)(C)CC3C3=CCC5C6(C)CC(O)C(OC7OC(CO)C(O)C(O)C7O)C(CO)(CO)C6CCC5(C)C3(C)CC4O)OCC(O)C2O)C(O)C(O)C1OC1OCC(O)C(OC2OC(CO)C(O)C(O)C2O)C1O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of Platicodoside C? |
| A: SMILES notation of Platicodoside C is CC1OC(OC2C(OC(=O)C34CCC(C)(C)CC3C3=CCC5C6(C)CC(O)C(OC7OC(CO)C(O)C(O)C7O)C(CO)(CO)C6CCC5(C)C3(C)CC4O)OCC(O)C2O)C(O)C(O)C1OC1OCC(O)C(OC2OC(CO)C(O)C(O)C2O)C1O. |
| Q: What is the InChIKey of Platicodoside C? |
| A: InChIKey of Platicodoside C is BXBACSOISVARGE-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 60657-91-2? |
| A: Chinese name of 60657-91-2 is 60657-91-2. |
| Q: What is the molecular weight of Platicodoside C? |
| A: Molecular weight of Platicodoside C is 1255.3. |
| Q: What is the English name of Platicodoside C? |
| A: The English name of Platicodoside C is Platicodoside C. |
| Q: What is the molecular formula of Platicodoside C? |
| A: Molecular formula of Platicodoside C is C58H94O29. |
| Q: What is the CAS number of Platicodoside C? |
| A: CAS number of Platicodoside C is 60657-91-2. |