ethyl 2-[3-hydroxy-2-oxo-3-(2-oxo-2-thiophen-2-ylethyl)indol-1-yl]acetate structure
|
Common Name | ethyl 2-[3-hydroxy-2-oxo-3-(2-oxo-2-thiophen-2-ylethyl)indol-1-yl]acetate | ||
|---|---|---|---|---|
| CAS Number | 6066-26-8 | Molecular Weight | 359.39600 | |
| Density | 1.371g/cm3 | Boiling Point | 629.8ºC at 760 mmHg | |
| Molecular Formula | C18H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.7ºC | |
| Name | ethyl 2-[3-hydroxy-2-oxo-3-(2-oxo-2-thiophen-2-ylethyl)indol-1-yl]acetate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.371g/cm3 |
|---|---|
| Boiling Point | 629.8ºC at 760 mmHg |
| Molecular Formula | C18H17NO5S |
| Molecular Weight | 359.39600 |
| Flash Point | 334.7ºC |
| Exact Mass | 359.08300 |
| PSA | 112.15000 |
| LogP | 2.18340 |
| Index of Refraction | 1.62 |
| InChIKey | PNKQWJSHWNXRPO-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CN1C(=O)C(O)(CC(=O)c2cccs2)c2ccccc21 |
|
~%
ethyl 2-[3-hydr... CAS#:6066-26-8 |
| Literature: Agnew,N.H.; Parrish,J.R. Journal of the Chemical Society [Section] C: Organic, 1966 , p. 203 - 208 |
| allyldiethylenetriamine |
| HMS613G09 |
| 1-Allyl-1,4,7-triazaheptan |