2,5-Diethoxy-2-(diethoxymethyl)oxolane structure
|
Common Name | 2,5-Diethoxy-2-(diethoxymethyl)oxolane | ||
|---|---|---|---|---|
| CAS Number | 60664-55-3 | Molecular Weight | 262.34300 | |
| Density | 1.01g/cm3 | Boiling Point | 324.7ºC at 760 mmHg | |
| Molecular Formula | C13H26O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 124.5ºC | |
| Name | 2-(diethoxymethyl)-2,5-diethoxyoxolane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 324.7ºC at 760 mmHg |
| Molecular Formula | C13H26O5 |
| Molecular Weight | 262.34300 |
| Flash Point | 124.5ºC |
| Exact Mass | 262.17800 |
| PSA | 46.15000 |
| LogP | 2.29130 |
| Index of Refraction | 1.447 |
| InChIKey | WAIRCAVHNPYSNP-UHFFFAOYSA-N |
| SMILES | CCOC1CCC(OCC)(C(OCC)OCC)O1 |
| HS Code | 2932190090 |
|---|
| HS Code | 2932190090 |
|---|---|
| Summary | 2932190090 other compounds containing an unfused furan ring (whether or not hydrogenated) in the structure VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:20.0% |
| 2-diethoxymethyl-2,5-diethoxy-tetrahydro-furan |
| FURAN,TETRAHYDRO-2,5-DIETHOXY-2-(DIETHOXYMETHYL) |
| 2,5-Diethoxy-2-(diethoxymethyl)tetrahydrofuran |
| 2,5-Diaethoxy-tetrahydro-furan-2-carbaldehyd-diaethylacetal |
| 2,5-diethoxy-tetrahydro-furan-2-carbaldehyde diethylacetal |
| Tetrahydro-2,5-diethoxy-2-(diethoxymethyl)furan |