S-Benzyl-L-cystein-S-oxide structure
|
Common Name | S-Benzyl-L-cystein-S-oxide | ||
|---|---|---|---|---|
| CAS Number | 60668-81-7 | Molecular Weight | 227.28000 | |
| Density | 1.39g/cm3 | Boiling Point | 504.5ºC at 760 mmHg | |
| Molecular Formula | C10H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 258.9ºC | |
| Name | (2R)-2-amino-3-benzylsulfinylpropanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 504.5ºC at 760 mmHg |
| Molecular Formula | C10H13NO3S |
| Molecular Weight | 227.28000 |
| Flash Point | 258.9ºC |
| Exact Mass | 227.06200 |
| PSA | 99.60000 |
| LogP | 1.91320 |
| Index of Refraction | 1.641 |
| InChIKey | OBQBHBOGTLPNJM-HJULIUOESA-N |
| SMILES | NC(CS(=O)Cc1ccccc1)C(=O)O |
| HS Code | 2930909090 |
|---|
|
~%
S-Benzyl-L-cyst... CAS#:60668-81-7 |
| Literature: Stoll; Seebeck Helvetica Chimica Acta, 1949 , vol. 32, p. 874 |
|
~%
S-Benzyl-L-cyst... CAS#:60668-81-7 |
| Literature: Funakoshi; Fujii; Akaji; et al. Chemical and Pharmaceutical Bulletin, 1979 , vol. 27, # 9 p. 2151 - 2156 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2930909090 |
|---|---|
| Summary | 2930909090. other organo-sulphur compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (2R)-2-Amino-3-(benzylsulfinyl)propanoic acid |