2-[[2-(benzenesulfonyloxy)phenyl]methylideneamino]guanidine structure
|
Common Name | 2-[[2-(benzenesulfonyloxy)phenyl]methylideneamino]guanidine | ||
|---|---|---|---|---|
| CAS Number | 6069-58-5 | Molecular Weight | 359.91700 | |
| Density | 1.37g/cm3 | Boiling Point | 559ºC at 760 mmHg | |
| Molecular Formula | C12H24O4Te | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 291.9ºC | |
| Name | Tellur-diisopropylat-mono-propylenglykolat |
|---|---|
| Synonym | More Synonyms |
| Density | 1.37g/cm3 |
|---|---|
| Boiling Point | 559ºC at 760 mmHg |
| Molecular Formula | C12H24O4Te |
| Molecular Weight | 359.91700 |
| Flash Point | 291.9ºC |
| Exact Mass | 362.07400 |
| PSA | 36.92000 |
| LogP | 2.63000 |
| Index of Refraction | 1.639 |
| InChIKey | VAJRDKPEIOTQIJ-UHFFFAOYSA-N |
| SMILES | CC1(C)O[Te]2(OC1(C)C)OC(C)(C)C(C)(C)O2 |
|
~%
2-[[2-(benzenes... CAS#:6069-58-5 |
| Literature: Denney,D.B.; Denney,D.Z.; Hammond,P.J. Journal of the American Chemical Society, 1981 , vol. 103, p. 2340 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| Tellur-dipinacolat |