N-[4-(2-Chlorophenoxy)phenylsulfonyl]glycine structure
|
Common Name | N-[4-(2-Chlorophenoxy)phenylsulfonyl]glycine | ||
|---|---|---|---|---|
| CAS Number | 606945-28-2 | Molecular Weight | 341.76700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H12ClNO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of N-[4-(2-Chlorophenoxy)phenylsulfonyl]glycine((4-(2-Chlorophenoxy)phenyl)sulfonyl)glycine used for scientific research and chemical synthesis intermediates. |
| Name | N-{[4-(2-Chlorophenoxy)phenyl]sulfonyl}glycine |
|---|
| Description | ((4-(2-Chlorophenoxy)phenyl)sulfonyl)glycine used for scientific research and chemical synthesis intermediates. |
|---|---|
| Related Catalog |
| Molecular Formula | C14H12ClNO5S |
|---|---|
| Molecular Weight | 341.76700 |
| Exact Mass | 341.01200 |
| PSA | 101.08000 |
| LogP | 3.96690 |
| InChIKey | OUJVPHDKPKCGPV-UHFFFAOYSA-N |
| SMILES | O=C(O)CNS(=O)(=O)c1ccc(Oc2ccccc2Cl)cc1 |