8-anilinonaphthalene-2-sulfonic acid structure
|
Common Name | 8-anilinonaphthalene-2-sulfonic acid | ||
|---|---|---|---|---|
| CAS Number | 607-13-6 | Molecular Weight | 299.34400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H13NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 8-anilinonaphthalene-2-sulfonic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H13NO3S |
|---|---|
| Molecular Weight | 299.34400 |
| Exact Mass | 299.06200 |
| PSA | 74.78000 |
| LogP | 4.98390 |
| InChIKey | RBCRBKCMJJQRDD-UHFFFAOYSA-N |
| SMILES | O=S(=O)(O)c1ccc2cccc(Nc3ccccc3)c2c1 |
|
~%
8-anilinonaphth... CAS#:607-13-6 |
| Literature: Bayer and Co. Patent: DE70349 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 513 |
|
~%
8-anilinonaphth... CAS#:607-13-6 |
| Literature: Akt.-Ges. f. Anilinf. Patent: DE159353 ; |
|
~%
8-anilinonaphth... CAS#:607-13-6 |
| Literature: Bayer and Co. Patent: DE70349 ; Fortschr. Teerfarbenfabr. Verw. Industriezweige, vol. 3, p. 514 |
| 8-anilino-naphthalene-2-sulfonic acid |
| 1-Anilinonaphthalin-7-sulfonat |
| 8-Anilino-naphthalin-2-sulfonsaeure |
| N-Phenyl-naphthylamin-(1)-sulfonsaeure-(7) |
| 2-Naphthalenesulfonic acid,8-(phenylamino) |