3-[7,12,17-tris-(2-carboxy-ethyl)-3,8,13,18-tetrakis-carboxymethyl-22,24-dihydro-porphin-2-yl]-propionic acid structure
|
Common Name | 3-[7,12,17-tris-(2-carboxy-ethyl)-3,8,13,18-tetrakis-carboxymethyl-22,24-dihydro-porphin-2-yl]-propionic acid | ||
|---|---|---|---|---|
| CAS Number | 607-14-7 | Molecular Weight | 830.74700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H38N4O16 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | uroporphyrin I |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C40H38N4O16 |
|---|---|
| Molecular Weight | 830.74700 |
| Exact Mass | 830.22800 |
| PSA | 354.70000 |
| LogP | 0.64060 |
| InChIKey | MOTVYDVWODTRDF-UHFFFAOYSA-N |
| SMILES | O=C(O)CCC1=C(CC(=O)O)c2cc3nc(cc4[nH]c(cc5[nH]c(cc1n2)c(CC(=O)O)c5CCC(=O)O)c(CC(=O)O)c4CCC(=O)O)C(CC(=O)O)=C3CCC(=O)O |
|
Name: Inhibition of HIV-1 P24 production.
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL708386
|
|
Name: Inhibition of HIV-1 P24 production.
Source: ChEMBL
Target: Human immunodeficiency virus 1
External Id: CHEMBL711391
|
| 3-[7,12,17-tris(2-carboxyethyl)-3,8,13,18-tetrakis(carboxymethyl)-21,22-dihydroporphyrin-2-yl]propanoic acid |
| 3,3',3'',3'''-(3,8,13,18-tetrakis-carboxymethyl-21H,23H-porphine-2,7,12,17-tetrayl)-tetrakis-propionic acid |
| 2,7,12,17-Porphinetetrapropionic acid |
| Uroporphyrin I |
| 3,3',3'',3'''-(3,8,13,18-Tetrakis-carboxymethyl-porphyrin-2,7,12,17-tetrayl)-tetra-propionsaeure |
| 3,8,13,18-tetrakis(carboxymethyl)porphyrin-2,7,12,17-tetrapropanoic acid |
| Urophorphyrin I |
| uroprophyrin I |
| 3,3',3'',3'''-(3,8,13,18-tetrakis-carboxymethyl-porphyrin-2,7,12,17-tetrayl)-tetra-propionic acid |
| 3,3',3'',3'''-[3,8,13,18-tetrakis(carboxymethyl)-2,7,12,17-porphyrintetrayl]tetrapropanoic acid |