diethyl 2-heptylpropanedioate
diethyl 2-heptylpropanedioate structure
|
Common Name | diethyl 2-heptylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 607-83-0 | Molecular Weight | 258.35400 | |
| Density | 0.967g/cm3 | Boiling Point | 151ºC | |
| Molecular Formula | C14H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | diethyl 2-heptylpropanedioate |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 0.967g/cm3 |
|---|---|
| Boiling Point | 151ºC |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35400 |
| Flash Point | 128.7ºC |
| Exact Mass | 258.18300 |
| PSA | 52.60000 |
| LogP | 3.08930 |
| Index of Refraction | 1.44 |
| InChIKey | HIJIXCXMVYTMCY-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(C(=O)OCC)C(=O)OCC |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2917190090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Heptyl-malonsaeure-diaethylester |
| Heptylmalonsaeure-diethylester |
| heptyl-malonic acid diethyl ester |
| Diethyl 2-heptylmalonate |
| Diethyl heptylmalonate |
| heptyl malonate d'ethyle |
| 2-heptanepropanedioic acid diethyl ester |
| Diethyl n-heptylmalonate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the boiling point of diethyl 2-heptylpropanedioate? |
| A: Boiling point of diethyl 2-heptylpropanedioate is 151ºC. |
| Q: What is the molecular weight of diethyl 2-heptylpropanedioate? |
| A: Molecular weight of diethyl 2-heptylpropanedioate is 258.35400. |
| Q: What is the InChIKey of diethyl 2-heptylpropanedioate? |
| A: InChIKey of diethyl 2-heptylpropanedioate is HIJIXCXMVYTMCY-UHFFFAOYSA-N. |
| Q: What is the CAS number of diethyl 2-heptylpropanedioate? |
| A: CAS number of diethyl 2-heptylpropanedioate is 607-83-0. |
| Q: What English synonyms does diethyl 2-heptylpropanedioate have? |
| A: English synonyms of diethyl 2-heptylpropanedioate: Heptyl-malonsaeure-diaethylester, Heptylmalonsaeure-diethylester, heptyl-malonic acid diethyl ester, Diethyl 2-heptylmalonate, Diethyl heptylmalonate, heptyl malonate d'ethyle, 2-heptanepropanedioic acid diethyl ester, Diethyl n-heptylmalonate. |
| Q: What is the English name of diethyl 2-heptylpropanedioate? |
| A: The English name of diethyl 2-heptylpropanedioate is diethyl 2-heptylpropanedioate. |
| Q: What is the SMILES notation of diethyl 2-heptylpropanedioate? |
| A: SMILES notation of diethyl 2-heptylpropanedioate is CCCCCCCC(C(=O)OCC)C(=O)OCC. |
| Q: What is the polar surface area (PSA) of diethyl 2-heptylpropanedioate? |
| A: Polar surface area (PSA) of diethyl 2-heptylpropanedioate is 52.60000. |
| Q: What is the LogP of diethyl 2-heptylpropanedioate? |
| A: LogP of diethyl 2-heptylpropanedioate is 3.08930. |
| Q: What is the molecular formula of diethyl 2-heptylpropanedioate? |
| A: Molecular formula of diethyl 2-heptylpropanedioate is C14H26O4. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |