diethyl 2-heptylpropanedioate
Modify Date: 2025-08-25 16:51:26
diethyl 2-heptylpropanedioate structure
|
Common Name | diethyl 2-heptylpropanedioate | ||
|---|---|---|---|---|
| CAS Number | 607-83-0 | Molecular Weight | 258.35400 | |
| Density | 0.967g/cm3 | Boiling Point | 151ºC | |
| Molecular Formula | C14H26O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.7ºC | |
| Name | diethyl 2-heptylpropanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.967g/cm3 |
|---|---|
| Boiling Point | 151ºC |
| Molecular Formula | C14H26O4 |
| Molecular Weight | 258.35400 |
| Flash Point | 128.7ºC |
| Exact Mass | 258.18300 |
| PSA | 52.60000 |
| LogP | 3.08930 |
| Index of Refraction | 1.44 |
| InChIKey | HIJIXCXMVYTMCY-UHFFFAOYSA-N |
| SMILES | CCCCCCCC(C(=O)OCC)C(=O)OCC |
| HS Code | 2917190090 |
|---|
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Heptyl-malonsaeure-diaethylester |
| Heptylmalonsaeure-diethylester |
| heptyl-malonic acid diethyl ester |
| Diethyl 2-heptylmalonate |
| Diethyl heptylmalonate |
| heptyl malonate d'ethyle |
| 2-heptanepropanedioic acid diethyl ester |
| Diethyl n-heptylmalonate |