4-Chloro-7-methoxyisatin structure
|
Common Name | 4-Chloro-7-methoxyisatin | ||
|---|---|---|---|---|
| CAS Number | 60706-07-2 | Molecular Weight | 211.60200 | |
| Density | 1.474g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-chloro-7-methoxy-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.474g/cm3 |
|---|---|
| Molecular Formula | C9H6ClNO3 |
| Molecular Weight | 211.60200 |
| Exact Mass | 211.00400 |
| PSA | 55.40000 |
| LogP | 1.62140 |
| Index of Refraction | 1.598 |
| InChIKey | VZPMNHWRRJFLFO-UHFFFAOYSA-N |
| SMILES | COc1ccc(Cl)c2c1NC(=O)C2=O |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-chloro-7-methoxy-indole-2,3-dione |
| 4-Chloro-7-methoxyisatin |
| 4-Chlor-7-methoxy-indolin-2,3-dion |
| 4-Chloro-7-methoxyindoline-2,3-dione |