2-[(3-nitrophenyl)methylidene]cycloheptan-1-one
![2-[(3-nitrophenyl)methylidene]cycloheptan-1-one Structure](https://image.chemsrc.com/caspic/032/60719-15-5.png)
2-[(3-nitrophenyl)methylidene]cycloheptan-1-one structure
|
Common Name | 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one | ||
|---|---|---|---|---|
| CAS Number | 60719-15-5 | Molecular Weight | 245.27400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H15NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C14H15NO3 |
|---|---|
| Molecular Weight | 245.27400 |
| Exact Mass | 245.10500 |
| PSA | 62.89000 |
| LogP | 4.03460 |
| InChIKey | FCJXKWDSDZGEHY-UHFFFAOYSA-N |
| SMILES | O=C1CCCCCC1=Cc1cccc([N+](=O)[O-])c1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2-[(3-nitrophen... CAS#:60719-15-5 |
| Literature: Mock,W.L.; Hartman,M.E. Journal of Organic Chemistry, 1977 , vol. 42, p. 459 - 465 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Cycloheptanone,2-[(3-nitrophenyl)methylene] |
| 2-(m-Nitrobenzyliden)cycloheptanon |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular formula of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: Molecular formula of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is C14H15NO3. |
| Q: What is the LogP of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: LogP of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is 4.03460. |
| Q: What is the CAS number of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: CAS number of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is 60719-15-5. |
| Q: What is the InChIKey of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: InChIKey of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is FCJXKWDSDZGEHY-UHFFFAOYSA-N. |
| Q: What is the SMILES notation of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: SMILES notation of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is O=C1CCCCCC1=Cc1cccc([N+](=O)[O-])c1. |
| Q: What is the English name of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: The English name of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one. |
| Q: What is the polar surface area (PSA) of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: Polar surface area (PSA) of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is 62.89000. |
| Q: What English synonyms does 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one have? |
| A: English synonyms of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one: Cycloheptanone,2-[(3-nitrophenyl)methylene], 2-(m-Nitrobenzyliden)cycloheptanon. |
| Q: What is the molecular weight of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one? |
| A: Molecular weight of 2-[(3-nitrophenyl)methylidene]cycloheptan-1-one is 245.27400. |
| Q: What is the Chinese name of 60719-15-5? |
| A: Chinese name of 60719-15-5 is 60719-15-5. |