dinoterbon structure
|
Common Name | dinoterbon | ||
|---|---|---|---|---|
| CAS Number | 6073-72-9 | Molecular Weight | 312.27500 | |
| Density | 1.299g/cm3 | Boiling Point | 406.1ºC at 760 mmHg | |
| Molecular Formula | C13H16N2O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 161.7ºC | |
| Name | dinoterbon |
|---|---|
| Synonym | More Synonyms |
| Density | 1.299g/cm3 |
|---|---|
| Boiling Point | 406.1ºC at 760 mmHg |
| Molecular Formula | C13H16N2O7 |
| Molecular Weight | 312.27500 |
| Flash Point | 161.7ºC |
| Exact Mass | 312.09600 |
| PSA | 127.17000 |
| LogP | 4.38220 |
| Index of Refraction | 1.54 |
| InChIKey | IXNUTQCZWAHNPN-UHFFFAOYSA-N |
| SMILES | CCOC(=O)Oc1c([N+](=O)[O-])cc([N+](=O)[O-])cc1C(C)(C)C |
| HS Code | 2920909090 |
|---|
| HS Code | 2920909090 |
|---|---|
| Summary | 2920909090 esters of other inorganic acids of non-metals (excluding esters of hydrogen halides) and their salts; their halogenated, sulphonated, nitrated or nitrosated derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-(1,1-dimethylethyl)-4,6-dinitrophenyl ethyl carbonate |
| (2-tert-butyl-4,6-dinitrophenyl) ethyl carbonate |
| Carbonic acid,2-(1,1-dimethylethyl)-4,6-dinitrophenyl ethyl ester |
| 2-t-Butyl-4,6-dinitrophenyl aethyl carbonat |
| 2-tert-butyl-4,6-dinitrophenyl ethyl carbonate |
| 2-tert-Butyl-4,6-dinitrophenyl ethyl carbonate |
| Dinoterbon [ISO] |
| Dinoterbon |