5-benzyl-3,3-dimethylcyclohexan-1-one
5-benzyl-3,3-dimethylcyclohexan-1-one structure
|
Common Name | 5-benzyl-3,3-dimethylcyclohexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 60741-72-2 | Molecular Weight | 216.31900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 5-benzyl-3,3-dimethylcyclohexan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H20O |
|---|---|
| Molecular Weight | 216.31900 |
| Exact Mass | 216.15100 |
| PSA | 17.07000 |
| LogP | 3.62450 |
| InChIKey | APOBTQQPBJRRCE-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)CC(Cc2ccccc2)C1 |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~72%
5-benzyl-3,3-di... CAS#:60741-72-2 |
| Literature: Kato; Hattori; Kawai; Sawa Chemical and Pharmaceutical Bulletin, 1983 , vol. 31, # 11 p. 3915 - 3923 |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Cyclohexanone,3,3-dimethyl-5-(phenylmethyl) |
| 3-benzyl-5,5-dimethylcyclohexanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the SMILES notation of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: SMILES notation of 5-benzyl-3,3-dimethylcyclohexan-1-one is CC1(C)CC(=O)CC(Cc2ccccc2)C1. |
| Q: What is the polar surface area (PSA) of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: Polar surface area (PSA) of 5-benzyl-3,3-dimethylcyclohexan-1-one is 17.07000. |
| Q: What English synonyms does 5-benzyl-3,3-dimethylcyclohexan-1-one have? |
| A: English synonyms of 5-benzyl-3,3-dimethylcyclohexan-1-one: Cyclohexanone,3,3-dimethyl-5-(phenylmethyl), 3-benzyl-5,5-dimethylcyclohexanone. |
| Q: What is the English name of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: The English name of 5-benzyl-3,3-dimethylcyclohexan-1-one is 5-benzyl-3,3-dimethylcyclohexan-1-one. |
| Q: What is the InChIKey of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: InChIKey of 5-benzyl-3,3-dimethylcyclohexan-1-one is APOBTQQPBJRRCE-UHFFFAOYSA-N. |
| Q: What is the CAS number of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: CAS number of 5-benzyl-3,3-dimethylcyclohexan-1-one is 60741-72-2. |
| Q: What is the molecular formula of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: Molecular formula of 5-benzyl-3,3-dimethylcyclohexan-1-one is C15H20O. |
| Q: What is the LogP of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: LogP of 5-benzyl-3,3-dimethylcyclohexan-1-one is 3.62450. |
| Q: What is the molecular weight of 5-benzyl-3,3-dimethylcyclohexan-1-one? |
| A: Molecular weight of 5-benzyl-3,3-dimethylcyclohexan-1-one is 216.31900. |
| Q: What is the Chinese name of 60741-72-2? |
| A: Chinese name of 60741-72-2 is 60741-72-2. |