N-(2-ethylphenyl)-5-phenyl-7-(trifluoromethyl)-1,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide
Modify Date: 2025-10-20 12:54:03
![N-(2-ethylphenyl)-5-phenyl-7-(trifluoromethyl)-1,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide Structure](https://image.chemsrc.com/caspic/484/6076-35-3.png)
N-(2-ethylphenyl)-5-phenyl-7-(trifluoromethyl)-1,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide structure
|
Common Name | N-(2-ethylphenyl)-5-phenyl-7-(trifluoromethyl)-1,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6076-35-3 | Molecular Weight | 414.42400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H21F3N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(2-ethylphenyl)-5-phenyl-7-(trifluoromethyl)-1,5,6,7-tetrahydropyrazolo[1,5-a]pyrimidine-2-carboxamide |
|---|
| Molecular Formula | C22H21F3N4O |
|---|---|
| Molecular Weight | 414.42400 |
| Exact Mass | 414.16700 |
| PSA | 65.67000 |
| LogP | 4.59960 |
| InChIKey | DMDSCTDBRKLCFS-UHFFFAOYSA-N |
| SMILES | CCc1ccccc1NC(=O)c1cc2n(n1)C(C(F)(F)F)CC(c1ccccc1)N2 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:69483-37-0|
Name: Fluorescence-based counterscreen assay for HCV NS3 helicase inhibitors of a ChemBridg...
Source: 1102
Target: N/A
External Id: 20130627FPNS3INTERFERECB
|
|
Name: Fluorescence polarization based primary biochemical high throughput screening assay o...
Source: 1102
Target: NS3 [Hepatitis C virus]
External Id: 20130624FPNS3DACB
|
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
Total 3, Current Page 1 of 1
1