Bis(triethoxysilylmethyl) sulfide structure
|
Common Name | Bis(triethoxysilylmethyl) sulfide | ||
|---|---|---|---|---|
| CAS Number | 60764-85-4 | Molecular Weight | 386.65200 | |
| Density | 1.008g/cm3 | Boiling Point | 332.8ºC at 760 mmHg | |
| Molecular Formula | C14H34O6SSi2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 155.1ºC | |
| Name | triethoxy(triethoxysilylmethylsulfanylmethyl)silane |
|---|---|
| Synonym | More Synonyms |
| Density | 1.008g/cm3 |
|---|---|
| Boiling Point | 332.8ºC at 760 mmHg |
| Molecular Formula | C14H34O6SSi2 |
| Molecular Weight | 386.65200 |
| Flash Point | 155.1ºC |
| Exact Mass | 386.16100 |
| PSA | 80.68000 |
| LogP | 3.73140 |
| Index of Refraction | 1.449 |
| InChIKey | QKMOHFJWHPXPHS-UHFFFAOYSA-N |
| SMILES | CCO[Si](CSC[Si](OCC)(OCC)OCC)(OCC)OCC |
|
~%
Bis(triethoxysi... CAS#:60764-85-4 |
| Literature: Voronkov,M.G. et al. Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), 1977 , vol. 26, p. 1710 - 1713 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, 1977 , vol. 26, p. 1849 - 1851 |
| bis-(triethoxysilanyl-methyl)-sulfane |
| Thiodimethylenebis(triethoxysilane) |
| Bis(triethoxysilylmethyl)sulfide |
| hexa-Si-ethoxy-Si,Si'-(2-thia-propane-1,3-diyl)-bis-silane |
| Bis-(triethoxysilyl-methyl)-sulfid |
| Silane,thiodimethylenebis(triethoxy |
| Sulfide,bis(triethoxysilylmethyl) |