4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine structure
|
Common Name | 4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine | ||
|---|---|---|---|---|
| CAS Number | 607740-08-9 | Molecular Weight | 466.16800 | |
| Density | 1.532 | Boiling Point | N/A | |
| Molecular Formula | C22H14Br2N2 | Melting Point | 197.0 to 201.0 °C | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-(3,5-Dibromophenyl)-2,6-diphenylpyrimidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.532 |
|---|---|
| Melting Point | 197.0 to 201.0 °C |
| Molecular Formula | C22H14Br2N2 |
| Molecular Weight | 466.16800 |
| Exact Mass | 463.95200 |
| PSA | 25.78000 |
| LogP | 7.00260 |
| InChIKey | DLXBSWIBLRUGFU-UHFFFAOYSA-N |
| SMILES | Brc1cc(Br)cc(-c2cc(-c3ccccc3)nc(-c3ccccc3)n2)c1 |
| HS Code | 2933599090 |
|---|
|
~57%
4-(3,5-Dibromop... CAS#:607740-08-9 |
| Literature: Idemitsu Kosan Co., Ltd.; IKEDA, Kiyoshi; ITO, Mitsunori Patent: EP2662368 A1, 2013 ; Location in patent: Paragraph 0183; 0184 ; |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| x4426 |