N-(2-ethylphenyl)-4-methyl-5-phenyl-2-[(2-phenylacetyl)amino]thiophene-3-carboxamide structure
|
Common Name | N-(2-ethylphenyl)-4-methyl-5-phenyl-2-[(2-phenylacetyl)amino]thiophene-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 6078-91-7 | Molecular Weight | 454.58300 | |
| Density | 1.242g/cm3 | Boiling Point | 612.6ºC at 760mmHg | |
| Molecular Formula | C28H26N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 324.3ºC | |
| Name | N-(2-ethylphenyl)-4-methyl-5-phenyl-2-[(2-phenylacetyl)amino]thiophene-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.242g/cm3 |
|---|---|
| Boiling Point | 612.6ºC at 760mmHg |
| Molecular Formula | C28H26N2O2S |
| Molecular Weight | 454.58300 |
| Flash Point | 324.3ºC |
| Exact Mass | 454.17100 |
| PSA | 93.42000 |
| LogP | 7.75290 |
| Index of Refraction | 1.671 |
| InChIKey | SOIRZMBYTXYCDF-UHFFFAOYSA-N |
| SMILES | CCc1ccccc1NC(=O)c1c(NC(=O)Cc2ccccc2)sc(-c2ccccc2)c1C |
|
~%
N-(2-ethylpheny... CAS#:6078-91-7 |
| Literature: Crowther,A.F. et al. Journal of Medicinal Chemistry, 1969 , vol. 12, # 4 p. 638 - 642 |
| 1-Cyclopentylamino-3-(3-methyl-phenoxy)-propanol-(2) |