clofibrylglycylglycine structure
|
Common Name | clofibrylglycylglycine | ||
|---|---|---|---|---|
| CAS Number | 60794-10-7 | Molecular Weight | 328.74800 | |
| Density | 1.328g/cm3 | Boiling Point | 659.1ºC at 760 mmHg | |
| Molecular Formula | C14H17ClN2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 352.4ºC | |
| Name | 2-[[2-[[2-(4-chlorophenoxy)-2-methylpropanoyl]amino]acetyl]amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 659.1ºC at 760 mmHg |
| Molecular Formula | C14H17ClN2O5 |
| Molecular Weight | 328.74800 |
| Flash Point | 352.4ºC |
| Exact Mass | 328.08300 |
| PSA | 111.71000 |
| LogP | 2.49500 |
| Index of Refraction | 1.551 |
| InChIKey | XUWBUKBIHUQVEN-UHFFFAOYSA-N |
| SMILES | CC(C)(Oc1ccc(Cl)cc1)C(=O)NCC(=O)NCC(=O)O |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Glycine,N-(N-(2-(4-chlorophenoxy)-2-methyl-1-oxopropyl)glycyl) |
| N-{N-[2-(p-Chlorophenoxy)-2-methylpropionyl]-glycyl}-glycin |
| Clofibrylglycylglycine |