2-hydroxy-2-propan-2-yl-propanedihydrazide structure
|
Common Name | 2-hydroxy-2-propan-2-yl-propanedihydrazide | ||
|---|---|---|---|---|
| CAS Number | 60807-06-9 | Molecular Weight | 190.20000 | |
| Density | 1.314g/cm3 | Boiling Point | 509.8ºC at 760 mmHg | |
| Molecular Formula | C6H14N4O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 262.1ºC | |
| Name | 2-hydroxy-2-propan-2-ylpropanedihydrazide |
|---|
| Density | 1.314g/cm3 |
|---|---|
| Boiling Point | 509.8ºC at 760 mmHg |
| Molecular Formula | C6H14N4O3 |
| Molecular Weight | 190.20000 |
| Flash Point | 262.1ºC |
| Exact Mass | 190.10700 |
| PSA | 130.47000 |
| Index of Refraction | 1.543 |
| InChIKey | CUQCEHDWKVHMTP-UHFFFAOYSA-N |
| SMILES | CC(C)C(O)(C(=O)NN)C(=O)NN |
|
~%
2-hydroxy-2-pro... CAS#:60807-06-9 |
| Literature: Portlock,D.E. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 781 - 788 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |