2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine
Modify Date: 2025-08-27 20:44:30
![2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine Structure](https://www.chemsrc.com/extcaspic/296/60840-85-9.png)
2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine structure
|
Common Name | 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine | ||
|---|---|---|---|---|
| CAS Number | 60840-85-9 | Molecular Weight | 292.33 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H24N2O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C12H24N2O6 |
|---|---|
| Molecular Weight | 292.33 |
| InChIKey | XPOYKYFSTMVWEA-UHFFFAOYSA-N |
| SMILES | CCN(CC)CC.O=C(O)CN(CC(=O)O)CC(=O)O |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: InChIKey of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is XPOYKYFSTMVWEA-UHFFFAOYSA-N. |
| Q: What is the molecular weight of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: Molecular weight of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is 292.33. |
| Q: What is the SMILES notation of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: SMILES notation of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is CCN(CC)CC.O=C(O)CN(CC(=O)O)CC(=O)O. |
| Q: What is the Chinese name of 60840-85-9? |
| A: Chinese name of 60840-85-9 is 60840-85-9. |
| Q: What is the English name of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: The English name of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine. |
| Q: What is the CAS number of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: CAS number of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is 60840-85-9. |
| Q: What is the molecular formula of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine? |
| A: Molecular formula of 2-[bis(carboxymethyl)amino]acetic acid;N,N-diethylethanamine is C12H24N2O6. |