9-methyl-benzo[5,6]chromeno[2,3-d]pyrimidin-12-one structure
|
Common Name | 9-methyl-benzo[5,6]chromeno[2,3-d]pyrimidin-12-one | ||
|---|---|---|---|---|
| CAS Number | 60870-57-7 | Molecular Weight | 262.26300 | |
| Density | 1.377g/cm3 | Boiling Point | 479.2ºC at 760 mmHg | |
| Molecular Formula | C16H10N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.6ºC | |
| Name | 9-methyl-benzo[5,6]chromeno[2,3-d]pyrimidin-12-one |
|---|
| Density | 1.377g/cm3 |
|---|---|
| Boiling Point | 479.2ºC at 760 mmHg |
| Molecular Formula | C16H10N2O2 |
| Molecular Weight | 262.26300 |
| Flash Point | 243.6ºC |
| Exact Mass | 262.07400 |
| PSA | 55.99000 |
| LogP | 3.19780 |
| Index of Refraction | 1.709 |
| InChIKey | MGXGOZYWOTUIRI-UHFFFAOYSA-N |
| SMILES | Cc1ncc2c(=O)c3c(ccc4ccccc43)oc2n1 |
|
~%
9-methyl-benzo[... CAS#:60870-57-7 |
| Literature: Roma,G. et al. Journal of Heterocyclic Chemistry, 1976 , vol. 13, p. 761 - 764 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |