BYK191023 structure
|
Common Name | BYK191023 | ||
|---|---|---|---|---|
| CAS Number | 608880-48-4 | Molecular Weight | 327.20900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H16Cl2N4O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BYK191023BYK191023 (BYK-191023) is a potent, highly selective inhibitor of inducible nitric-oxide synthase (iNOS) with IC50 of 86 nM, >20-fold selectivity over nNOS and eNOS (IC50=17 and 162 uM). |
| Name | 2-[2-(4-methoxypyridin-2-yl)ethyl]-1H-imidazo[4,5-b]pyridine |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H16Cl2N4O |
|---|---|
| Molecular Weight | 327.20900 |
| Exact Mass | 326.07000 |
| PSA | 63.69000 |
| LogP | 3.75070 |
| InChIKey | YBOCDKFRGBOOFO-UHFFFAOYSA-N |
| SMILES | COc1ccnc(CCc2nc3ncccc3[nH]2)c1 |
| mpw |
| BYK191023 |