(2α,3β)- 2,3-Bis(acetyloxy)-olean- 12-en-28-oic acid
(2α,3β)- 2,3-Bis(acetyloxy)-olean- 12-en-28-oic acid structure
|
Common Name | (2α,3β)- 2,3-Bis(acetyloxy)-olean- 12-en-28-oic acid | ||
|---|---|---|---|---|
| CAS Number | 6089-92-5 | Molecular Weight | 556.77300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C34H52O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C34H52O6 |
|---|---|
| Molecular Weight | 556.77300 |
| Exact Mass | 556.37600 |
| PSA | 89.90000 |
| LogP | 7.34600 |
| InChIKey | BZDICYRSPZNHNV-LULZRBEKSA-N |
| SMILES | CC(=O)OC1CC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C(=O)O)CCC23C)C(C)(C)C1OC(C)=O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:4373-41-5This table contains target information, in‑vitro & in‑vivo assay data for this compound.
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| crategolic acid diacetate |
| diacetylmaslinic acid |
| maslinic acid diacetate |
| 2,3-di-O-acetylmaslinic acid |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: CAS number of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is 6089-92-5. |
| Q: What English synonyms does (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid have? |
| A: English synonyms of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid: crategolic acid diacetate, diacetylmaslinic acid, maslinic acid diacetate, 2,3-di-O-acetylmaslinic acid. |
| Q: What is the molecular formula of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: Molecular formula of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is C34H52O6. |
| Q: What is the polar surface area (PSA) of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: Polar surface area (PSA) of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is 89.90000. |
| Q: What is the LogP of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: LogP of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is 7.34600. |
| Q: What is the SMILES notation of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: SMILES notation of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is CC(=O)OC1CC2(C)C(CCC3(C)C2CC=C2C4CC(C)(C)CCC4(C(=O)O)CCC23C)C(C)(C)C1OC(C)=O. |
| Q: What is the Chinese name of 6089-92-5? |
| A: Chinese name of 6089-92-5 is 6089-92-5. |
| Q: What are the downstream products of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: Related downstream products(CAS) of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid: 4373-41-5. |
| Q: What is the English name of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: The English name of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid. |
| Q: What is the InChIKey of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid? |
| A: InChIKey of (2α,3β)-2,3-diacetoxy-olean-12-en-28-acid is BZDICYRSPZNHNV-LULZRBEKSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |