2-Amino-5-methyl benzenesulfonamide
2-Amino-5-methyl benzenesulfonamide structure
|
Common Name | 2-Amino-5-methyl benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 609-55-2 | Molecular Weight | 186.23100 | |
| Density | 1.359 g/cm3 | Boiling Point | 403.8ºC at 760 mmHg | |
| Molecular Formula | C7H10N2O2S | Melting Point | 118-120ºC | |
| MSDS | N/A | Flash Point | 198ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 2-amino-5-methylbenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.359 g/cm3 |
|---|---|
| Boiling Point | 403.8ºC at 760 mmHg |
| Melting Point | 118-120ºC |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.23100 |
| Flash Point | 198ºC |
| Exact Mass | 186.04600 |
| PSA | 94.56000 |
| LogP | 2.58690 |
| Index of Refraction | 1.609 |
| InChIKey | GKTVIFGJASUBGA-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N)c(S(N)(=O)=O)c1 |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2935009090 |
|---|
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
![7-METHYL-1,1-DIOXO-1,4-DIHYDRO-2H-1LAMBDA6-BENZO[1,2,4]THIADIAZIN-3-ONE structure](https://image.chemsrc.com/caspic/480/71254-63-2.png)
![N-[(4-methylphenyl)carbamoyl]sulfamoyl chloride structure](https://image.chemsrc.com/caspic/258/380885-39-2.png)
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 5 | |
|---|---|
| DownStream 0 | |
This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| Benzenesulfonamide,2-amino-5-methyl |
| BEN114 |
| 2-amino-5-methyl-benzenesulfonamide |
| 2-amino-5-methylbenzenesulphonamide |
| 5-amino-2-methylbenzenesulfonimide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the polar surface area (PSA) of 2-amino-5-methylbenzenesulfonamide? |
| A: Polar surface area (PSA) of 2-amino-5-methylbenzenesulfonamide is 94.56000. |
| Q: What is the SMILES notation of 2-amino-5-methylbenzenesulfonamide? |
| A: SMILES notation of 2-amino-5-methylbenzenesulfonamide is Cc1ccc(N)c(S(N)(=O)=O)c1. |
| Q: What English synonyms does 2-amino-5-methylbenzenesulfonamide have? |
| A: English synonyms of 2-amino-5-methylbenzenesulfonamide: Benzenesulfonamide,2-amino-5-methyl, BEN114, 2-amino-5-methyl-benzenesulfonamide, 2-amino-5-methylbenzenesulphonamide, 5-amino-2-methylbenzenesulfonimide. |
| Q: What are the upstream materials of 2-amino-5-methylbenzenesulfonamide? |
| A: Related upstream materials(CAS) of 2-amino-5-methylbenzenesulfonamide: 71254-63-2;855941-97-8;55825-29-1;380885-39-2;106-49-0. |
| Q: What is the LogP of 2-amino-5-methylbenzenesulfonamide? |
| A: LogP of 2-amino-5-methylbenzenesulfonamide is 2.58690. |
| Q: What is the melting point of 2-amino-5-methylbenzenesulfonamide? |
| A: Melting point of 2-amino-5-methylbenzenesulfonamide is 118-120ºC. |
| Q: What is the boiling point of 2-amino-5-methylbenzenesulfonamide? |
| A: Boiling point of 2-amino-5-methylbenzenesulfonamide is 403.8ºC at 760 mmHg. |
| Q: What is the molecular weight of 2-amino-5-methylbenzenesulfonamide? |
| A: Molecular weight of 2-amino-5-methylbenzenesulfonamide is 186.23100. |
| Q: What is the InChIKey of 2-amino-5-methylbenzenesulfonamide? |
| A: InChIKey of 2-amino-5-methylbenzenesulfonamide is GKTVIFGJASUBGA-UHFFFAOYSA-N. |
| Q: What is the English name of 2-amino-5-methylbenzenesulfonamide? |
| A: The English name of 2-amino-5-methylbenzenesulfonamide is 2-amino-5-methylbenzenesulfonamide. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |