N,N''-(4-Methyl-1,3-phenylene)bis[N'-methylurea] structure
|
Common Name | N,N''-(4-Methyl-1,3-phenylene)bis[N'-methylurea] | ||
|---|---|---|---|---|
| CAS Number | 60903-51-7 | Molecular Weight | 236.27000 | |
| Density | 1.246g/cm3 | Boiling Point | 344.6ºC at 760 mmHg | |
| Molecular Formula | C11H16N4O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 128.7ºC | |
| Name | 1-methyl-3-[2-methyl-5-(methylcarbamoylamino)phenyl]urea |
|---|
| Density | 1.246g/cm3 |
|---|---|
| Boiling Point | 344.6ºC at 760 mmHg |
| Molecular Formula | C11H16N4O2 |
| Molecular Weight | 236.27000 |
| Flash Point | 128.7ºC |
| Exact Mass | 236.12700 |
| PSA | 89.24000 |
| LogP | 2.05240 |
| Index of Refraction | 1.622 |
| InChIKey | ZHNZOYGZVBMVGZ-UHFFFAOYSA-N |
| SMILES | CNC(=O)Nc1ccc(C)c(NC(=O)NC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |