1-chloro-4-(chloromethyl)-2,3,5,6-tetrafluorobenzene
Modify Date: 2025-10-19 19:24:42
1-chloro-4-(chloromethyl)-2,3,5,6-tetrafluorobenzene structure
|
Common Name | 1-chloro-4-(chloromethyl)-2,3,5,6-tetrafluorobenzene | ||
|---|---|---|---|---|
| CAS Number | 60903-83-5 | Molecular Weight | 232.99000 | |
| Density | 1.596g/cm3 | Boiling Point | 193.4ºC at 760 mmHg | |
| Molecular Formula | C7H2Cl2F4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 79ºC | |
| Name | 1-chloro-4-(chloromethyl)-2,3,5,6-tetrafluorobenzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.596g/cm3 |
|---|---|
| Boiling Point | 193.4ºC at 760 mmHg |
| Molecular Formula | C7H2Cl2F4 |
| Molecular Weight | 232.99000 |
| Flash Point | 79ºC |
| Exact Mass | 231.94700 |
| LogP | 3.63520 |
| Index of Refraction | 1.472 |
| InChIKey | JFJHGLHUIPYFAE-UHFFFAOYSA-N |
| SMILES | Fc1c(F)c(CCl)c(F)c(F)c1Cl |
| HS Code | 2903999090 |
|---|
| HS Code | 2903999090 |
|---|---|
| Summary | 2903999090 halogenated derivatives of aromatic hydrocarbons VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| C144 |
| 4-CHLORO-2,3,5,6-TETRAFLUORO-BENZYLCHLORIDE |
| 4-Chlor-2,3,5,6-tetrafluor-1-chlormethyl-benzol |