5-amino-3-bromo-2-nitrobenzoic acid
Modify Date: 2025-08-25 10:48:14
5-amino-3-bromo-2-nitrobenzoic acid structure
|
Common Name | 5-amino-3-bromo-2-nitrobenzoic acid | ||
|---|---|---|---|---|
| CAS Number | 60912-51-8 | Molecular Weight | 261.03000 | |
| Density | 1.973g/cm3 | Boiling Point | 468.1ºC at 760 mmHg | |
| Molecular Formula | C7H5BrN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.9ºC | |
| Name | 5-amino-3-bromo-2-nitrobenzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.973g/cm3 |
|---|---|
| Boiling Point | 468.1ºC at 760 mmHg |
| Molecular Formula | C7H5BrN2O4 |
| Molecular Weight | 261.03000 |
| Flash Point | 236.9ºC |
| Exact Mass | 259.94300 |
| PSA | 109.14000 |
| LogP | 2.74210 |
| Index of Refraction | 1.709 |
| InChIKey | VECCFFGGNNEGSY-UHFFFAOYSA-N |
| SMILES | Nc1cc(Br)c([N+](=O)[O-])c(C(=O)O)c1 |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 5-Amino-3-bromo-2-nitro-benzoic acid |
| 3-Bromo-2-nitro-5-amino-benzoesaeure |