methyl 4-nitropyridine-2-carboxylate 1-oxide structure
|
Common Name | methyl 4-nitropyridine-2-carboxylate 1-oxide | ||
|---|---|---|---|---|
| CAS Number | 60923-20-8 | Molecular Weight | 198.13300 | |
| Density | 1.48g/cm3 | Boiling Point | 447.3ºC at 760 mmHg | |
| Molecular Formula | C7H6N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 224.3ºC | |
| Name | methyl 4-nitro-1-oxidopyridin-1-ium-2-carboxylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 447.3ºC at 760 mmHg |
| Molecular Formula | C7H6N2O5 |
| Molecular Weight | 198.13300 |
| Flash Point | 224.3ºC |
| Exact Mass | 198.02800 |
| PSA | 97.58000 |
| LogP | 1.33310 |
| Index of Refraction | 1.587 |
| InChIKey | FWXJLEXAELCZOA-UHFFFAOYSA-N |
| SMILES | COC(=O)c1cc([N+](=O)[O-])cc[n+]1[O-] |
| HS Code | 2933399090 |
|---|
|
~%
methyl 4-nitrop... CAS#:60923-20-8 |
| Literature: Krause; Langenbeck Chemische Berichte, 1959 , vol. 92, p. 155,158 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| methyl 4-nitropyridine-2-carboxylate 1-oxide |
| 4-nitro-1-oxy-pyridine-2-carboxylic acid methyl ester |
| 4-Nitro-picolinsaeure-N-oxid-methylester |
| 4-Nitro-1-oxy-pyridin-2-carbonsaeure-methylester |
| EINECS 262-526-9 |