4-[1-benzoyl-3-(4-ethoxyphenyl)-5-phenyl-pyrazol-4-yl]diazenyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide structure
|
Common Name | 4-[1-benzoyl-3-(4-ethoxyphenyl)-5-phenyl-pyrazol-4-yl]diazenyl-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 60929-08-0 | Molecular Weight | 649.74200 | |
| Density | 1.39g/cm3 | Boiling Point | 876.4ºC at 760 mmHg | |
| Molecular Formula | C33H27N7O4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 483.8ºC | |
| Name | 4-[[1-benzoyl-3-(4-ethoxyphenyl)-5-phenylpyrazol-4-yl]diazenyl]-N-(5-methyl-1,3,4-thiadiazol-2-yl)benzenesulfonamide |
|---|
| Density | 1.39g/cm3 |
|---|---|
| Boiling Point | 876.4ºC at 760 mmHg |
| Molecular Formula | C33H27N7O4S2 |
| Molecular Weight | 649.74200 |
| Flash Point | 483.8ºC |
| Exact Mass | 649.15700 |
| PSA | 177.41000 |
| LogP | 8.83420 |
| Index of Refraction | 1.702 |
| InChIKey | CBIUFJZZLQEQAK-UHFFFAOYSA-N |
| SMILES | CCOc1ccc(-c2nn(C(=O)c3ccccc3)c(-c3ccccc3)c2N=Nc2ccc(S(=O)(=O)Nc3nnc(C)s3)cc2)cc1 |
|
~%
4-[1-benzoyl-3-... CAS#:60929-08-0 |
| Literature: Kabra; Saharia; Sharma Journal of the Indian Chemical Society, 1976 , vol. 53, # 4 p. 371 - 374 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |