3-(2,4-Dimethoxy-phenyl)-3-oxo-propionic acid ethyl ester structure
|
Common Name | 3-(2,4-Dimethoxy-phenyl)-3-oxo-propionic acid ethyl ester | ||
|---|---|---|---|---|
| CAS Number | 60946-77-2 | Molecular Weight | 252.26300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H16O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | ethyl 3-(2,4-dimethoxyphenyl)-3-oxopropanoate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H16O5 |
|---|---|
| Molecular Weight | 252.26300 |
| Exact Mass | 252.10000 |
| PSA | 61.83000 |
| LogP | 1.83970 |
| InChIKey | QRKTUHDGFMRYGB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)c1ccc(OC)cc1OC |
| HS Code | 2918990090 |
|---|
|
~85%
3-(2,4-Dimethox... CAS#:60946-77-2 |
| Literature: Al-Rifai, Nafisah; Ruecker, Hannelore; Amslinger, Sabine Chemistry - A European Journal, 2013 , vol. 19, # 45 p. 15384 - 15395 |
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| Aethyl-2.4-dimethoxybenzoylacetat |