acepromazine structure
|
Common Name | acepromazine | ||
|---|---|---|---|---|
| CAS Number | 61-00-7 | Molecular Weight | 326.45600 | |
| Density | 1.1075 (rough estimate) | Boiling Point | bp0.5 220-240° | |
| Molecular Formula | C19H22N2OS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | acepromazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1075 (rough estimate) |
|---|---|
| Boiling Point | bp0.5 220-240° |
| Molecular Formula | C19H22N2OS |
| Molecular Weight | 326.45600 |
| Exact Mass | 326.14500 |
| PSA | 48.85000 |
| LogP | 4.50860 |
| Index of Refraction | 1.5950 (estimate) |
| InChIKey | NOSIYYJFMPDDSA-UHFFFAOYSA-N |
| SMILES | CC(=O)c1ccc2c(c1)N(CCCN(C)C)c1ccccc1S2 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2934300000 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 1 | |
| HS Code | 2934300000 |
|---|---|
| Summary | 2934300000. other compounds containing in the structure a phenothiazine ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Binding affinity towards human GABRA1 in an in vitro assay with cellular components m...
Source: ChEMBL
Target: Gamma-aminobutyric acid receptor subunit gamma-2
External Id: CHEMBL5291799
|
|
Name: Primary qHTS for small molecule stabilizers of the endoplasmic reticulum resident pro...
Source: NCGC
Target: N/A
External Id: SERCaMPGLuc-p1-antagonist
|
|
Name: Cell Viability qHTS for small molecule stabilizers of the endoplasmic reticulum resid...
Source: NCGC
Target: N/A
External Id: SERCaMPGluc-f3-cellviability-42h
|
|
Name: Confirmatory qHTS for small molecule stabilizers of the endoplasmic reticulum residen...
Source: NCGC
Target: N/A
External Id: SERCaMPGLuc-f1_f3-antagonist
|
|
Name: Counterscreen qHTS for small molecule stabilizers of the endoplasmic reticulum reside...
Source: NCGC
Target: N/A
External Id: SERCaMPGLuc-f3-counterscreen-19h
|
|
Name: Binding affinity towards human ESR1 in an in vitro cell free assay (CRO assay) measur...
Source: ChEMBL
Target: Estrogen receptor
External Id: CHEMBL5291792
|
|
Name: Binding affinity towards human DRD1 in an in vitro assay with cellular components (NI...
Source: ChEMBL
Target: D(1A) dopamine receptor
External Id: CHEMBL5291919
|
|
Name: Compound was evaluated for inhibition of human F2 in an in vitro cell free assay meas...
Source: ChEMBL
Target: Prothrombin
External Id: CHEMBL5291794
|
|
Name: Inhibition of human BSEP expressed in baculovirus transfected fall armyworm Sf21 cell...
Source: ChEMBL
Target: Bile salt export pump
External Id: CHEMBL4017550
|
|
Name: Vibrio cholerae assay for pro-quorum sensing small molecules
Source: Southern Research Specialized Biocontainment Screening Center
Target: cyclic AMP receptor protein [Vibrio cholerae O1 biovar El Tor str. N16961]
External Id: Vcholera_QS_Pilot
|
| Vetranquil |
| 1522CB |
| 1-[10-(3-Dimethylamino-propyl)-phenothiazin-2-yl]-aethanon |
| Notensil |
| Acetylperazine |
| Acetopromazine |
| Acetylpromazine |
| 1-[10-(3-dimethylamino-propyl)-phenothiazin-2-yl]-ethanone |