n,n-dipropyltryptamine structure
|
Common Name | n,n-dipropyltryptamine | ||
|---|---|---|---|---|
| CAS Number | 61-52-9 | Molecular Weight | 244.37500 | |
| Density | 1.014 g/cm3 | Boiling Point | 387.4ºC at 760 mmHg | |
| Molecular Formula | C16H24N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-[2-(1H-indol-3-yl)ethyl]-N-propylpropan-1-amine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.014 g/cm3 |
|---|---|
| Boiling Point | 387.4ºC at 760 mmHg |
| Molecular Formula | C16H24N2 |
| Molecular Weight | 244.37500 |
| Exact Mass | 244.19400 |
| PSA | 19.03000 |
| LogP | 3.83240 |
| Index of Refraction | 1.574 |
| InChIKey | BOOQTIHIKDDPRW-UHFFFAOYSA-N |
| SMILES | CCCN(CCC)CCc1c[nH]c2ccccc12 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| HS Code | 2933990090 |
|---|
|
~94%
n,n-dipropyltry... CAS#:61-52-9 |
| Literature: Qu, Shi-Jin; Wang, Gui-Feng; Duan, Wen-Hu; Yao, Shan-Yan; Zuo, Jian-Ping; Tan, Chang-Heng; Zhu, Da-Yuan Bioorganic and Medicinal Chemistry, 2011 , vol. 19, # 10 p. 3120 - 3127 |
|
~47%
n,n-dipropyltry... CAS#:61-52-9 |
| Literature: Thiagaraj, Harish V.; Russo, Ethan B.; Burnett, Andrea; Goldstein, Eric; Thompson, Charles M.; Parker, Keith K. Pharmacology, 2005 , vol. 74, # 4 p. 193 - 199 |
|
~%
n,n-dipropyltry... CAS#:61-52-9 |
| Literature: Bollettino Scientifico della Facolta di Chimica Industriale di Bologna, , vol. 17, p. 84,86 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Name: Selectivity index, ratio of CC50 for human HepG2.2.15 cells to IC50 for Hepatitis B v...
Source: ChEMBL
Target: N/A
External Id: CHEMBL1781476
|
|
Name: Cytotoxicity against human HepG2(2.2.15) cells after 8 days by MTT assay
Source: ChEMBL
Target: N/A
External Id: CHEMBL1781475
|
|
Name: Biochemical firefly luciferase enzyme assay for NPC
Source: NCGC
Target: Luciferase [Photinus pyralis]
External Id: adst-fluc-km-fda-o1_regid
|
|
Name: Antiviral activity against Hepatitis B virus infected in human HepG2(2.2.15) cells as...
Source: ChEMBL
Target: Hepatitis B virus
External Id: CHEMBL1781474
|
| (2-indol-3-yl-ethyl)-dipropyl-amine |
| (2-Indol-3-yl-aethyl)-dipropyl-amin |
| MFCD01718836 |
| Dipropyltryptamine |
| INDOLE,3-(2-(DIPROPYLAMINO)ETHYL) |
| N-(2-(1H-indol-3-yl)ethyl)-N-propylpropan-1-amine |
| 3-(2-(Dipropylamino)ethyl)indole |
| 1H-Indole-3-ethanamine,N,N-dipropyl |
| N,N-Dipropyltryptamine |