2-[4-(2,4,6-Trimethyl-benzyl)-piperazin-1-yl]-ethanol; compound with (Z)-but-2-enedioic acid structure
|
Common Name | 2-[4-(2,4,6-Trimethyl-benzyl)-piperazin-1-yl]-ethanol; compound with (Z)-but-2-enedioic acid | ||
|---|---|---|---|---|
| CAS Number | 61014-79-7 | Molecular Weight | 378.46300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H30N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-[4-(2,4,6-Trimethyl-benzyl)-piperazin-1-yl]-ethanol; compound with (Z)-but-2-enedioic acid |
|---|
| Molecular Formula | C20H30N2O5 |
|---|---|
| Molecular Weight | 378.46300 |
| Exact Mass | 378.21500 |
| PSA | 101.31000 |
| LogP | 1.30930 |
| InChIKey | QYEWFMJNXXQFGM-WLHGVMLRSA-N |
| SMILES | Cc1cc(C)c(CN2CCN(CCO)CC2)c(C)c1.O=C(O)C=CC(=O)O |