3-[4-(4-methylphenyl)piperazin-1-yl]propanamide structure
|
Common Name | 3-[4-(4-methylphenyl)piperazin-1-yl]propanamide | ||
|---|---|---|---|---|
| CAS Number | 61015-49-4 | Molecular Weight | 247.33600 | |
| Density | 1.104g/cm3 | Boiling Point | 475.7ºC at 760 mmHg | |
| Molecular Formula | C14H21N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.5ºC | |
| Name | 3-[4-(4-methylphenyl)piperazin-1-yl]propanamide |
|---|
| Density | 1.104g/cm3 |
|---|---|
| Boiling Point | 475.7ºC at 760 mmHg |
| Molecular Formula | C14H21N3O |
| Molecular Weight | 247.33600 |
| Flash Point | 241.5ºC |
| Exact Mass | 247.16800 |
| PSA | 49.57000 |
| LogP | 1.69560 |
| Index of Refraction | 1.559 |
| InChIKey | SSEOVBDXLWSATJ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(N2CCN(CCC(N)=O)CC2)cc1 |
|
~%
3-[4-(4-methylp... CAS#:61015-49-4 |
| Literature: Pollard et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2989 |
|
~%
3-[4-(4-methylp... CAS#:61015-49-4 |
| Literature: Pollard et al. Journal of the American Chemical Society, 1953 , vol. 75, p. 2989 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |