N-(4-dimethylamino-3-methyl-phenyl)acetamide structure
|
Common Name | N-(4-dimethylamino-3-methyl-phenyl)acetamide | ||
|---|---|---|---|---|
| CAS Number | 61015-97-2 | Molecular Weight | 192.25800 | |
| Density | 1.087g/cm3 | Boiling Point | 355.2ºC at 760 mmHg | |
| Molecular Formula | C11H16N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 168.6ºC | |
| Name | N-[4-(dimethylamino)-3-methylphenyl]acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.087g/cm3 |
|---|---|
| Boiling Point | 355.2ºC at 760 mmHg |
| Molecular Formula | C11H16N2O |
| Molecular Weight | 192.25800 |
| Flash Point | 168.6ºC |
| Exact Mass | 192.12600 |
| PSA | 32.34000 |
| LogP | 2.09240 |
| Index of Refraction | 1.59 |
| InChIKey | GBBBKTOWNUUREU-UHFFFAOYSA-N |
| SMILES | CC(=O)Nc1ccc(N(C)C)c(C)c1 |
|
~%
N-(4-dimethylam... CAS#:61015-97-2 |
| Literature: Fieser; Thompson Journal of the American Chemical Society, 1939 , vol. 61, p. 376,379 Full Text Show Details Nenitzescu; Vantu Chemische Berichte, 1944 , vol. 77/79, p. 705,709 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| N,N-Dimethyl-2-methyl-N'-acetyl-p-phenylendiamin |
| 2.N1.N1-Trimethyl-N4-acetyl-p-phenylendiamin |