4-AMINO-5-(2-BROMOPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 4-AMINO-5-(2-BROMOPHENYL)-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 61055-40-1 | Molecular Weight | 271.13700 | |
| Density | 1.9g/cm3 | Boiling Point | 364.6ºC at 760 mmHg | |
| Molecular Formula | C8H7BrN4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 174.3ºC | |
| Name | 4-amino-3-(2-bromophenyl)-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.9g/cm3 |
|---|---|
| Boiling Point | 364.6ºC at 760 mmHg |
| Molecular Formula | C8H7BrN4S |
| Molecular Weight | 271.13700 |
| Flash Point | 174.3ºC |
| Exact Mass | 269.95700 |
| PSA | 95.53000 |
| LogP | 2.29130 |
| Index of Refraction | 1.803 |
| InChIKey | JAKRMPFVBCPVRZ-UHFFFAOYSA-N |
| SMILES | Nn1c(-c2ccccc2Br)n[nH]c1=S |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4h-1,2,4-triazole-3-thiol,4-amino-5-(2-bromophenyl) |
| 4-amino-5-(2-bromo-phenyl)-2,4-dihydro-[1,2,4]triazole-3-thione |
| 4-amino-5-(2-bromophenyl)-1,2,4-triazole-3-thiol |
| 4-amino-5-(2-bromophenyl)-4H-1,2,4-triazole-3-thiol |
| 5-(2-Bromophenyl)-4-amino-3-mercapto-4H-1,2,4-triazole |