2,2,5,5-tetramethyl-1-phenylhexan-1-one structure
|
Common Name | 2,2,5,5-tetramethyl-1-phenylhexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61067-10-5 | Molecular Weight | 232.36100 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H24O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,5,5-tetramethyl-1-phenylhexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H24O |
|---|---|
| Molecular Weight | 232.36100 |
| Exact Mass | 232.18300 |
| PSA | 17.07000 |
| LogP | 4.72180 |
| InChIKey | RUKCSDKRLUUZIY-UHFFFAOYSA-N |
| SMILES | CC(C)(C)CCC(C)(C)C(=O)c1ccccc1 |
|
~%
2,2,5,5-tetrame... CAS#:61067-10-5 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| 1-Phenyl-2,2,5,5-tetramethyl-1-hexanon |
| 1-Hexanone,2,2,5,5-tetramethyl-1-phenyl |