1-[4-(dimethylamino)phenyl]-2,2-dimethylhexan-1-one structure
|
Common Name | 1-[4-(dimethylamino)phenyl]-2,2-dimethylhexan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61067-12-7 | Molecular Weight | 247.37600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H25NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-[4-(dimethylamino)phenyl]-2,2-dimethylhexan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C16H25NO |
|---|---|
| Molecular Weight | 247.37600 |
| Exact Mass | 247.19400 |
| PSA | 20.31000 |
| LogP | 4.15170 |
| InChIKey | FDNZOZCPMSYSPQ-UHFFFAOYSA-N |
| SMILES | CCCCC(C)(C)C(=O)c1ccc(N(C)C)cc1 |
|
~%
1-[4-(dimethyla... CAS#:61067-12-7 |
| Literature: Couture,A. et al. Journal of the American Chemical Society, 1976 , vol. 98, p. 6218 - 6225 |
| 1-Hexanone,1-[4-(dimethylamino)phenyl]-2,2-dimethyl |
| 1-p-Dimethylaminophenyl-2,2-dimethyl-1-hexanon |