2,2,4-trimethyl-1-phenylpentan-1-one structure
|
Common Name | 2,2,4-trimethyl-1-phenylpentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 61067-15-0 | Molecular Weight | 204.30800 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C14H20O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2,2,4-trimethyl-1-phenylpentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C14H20O |
|---|---|
| Molecular Weight | 204.30800 |
| Exact Mass | 204.15100 |
| PSA | 17.07000 |
| LogP | 3.94160 |
| InChIKey | CIAVXCLFBCPEQZ-UHFFFAOYSA-N |
| SMILES | CC(C)CC(C)(C)C(=O)c1ccccc1 |
|
~%
2,2,4-trimethyl... CAS#:61067-15-0 |
| Literature: Beckwith,A.L.J. Journal of the Chemical Society, 1962 , p. 2248 - 2257 |
| 1-Pentanone,2,2,4-trimethyl-1-phenyl |
| 2,2,4-Trimethyl-1-phenyl-pentanon-(1) |