3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one
Modify Date: 2026-06-25 15:04:52
3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one structure
|
Common Name | 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one | ||
|---|---|---|---|---|
| CAS Number | 610763-99-0 | Molecular Weight | 460.5 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C27H24O7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C27H24O7 |
|---|---|
| Molecular Weight | 460.5 |
| InChIKey | ZBBCWBZDIXYSBA-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)C2=C(O1)C=C(C=C2)OCC(=O)C3=CC=C(C=C3)OC)C4=CC(=C(C=C4)OC)OC |
This table contains target information, in‑vitro & in‑vivo assay data for this compound.
|
Name: Alphascreen assay for small molecules abrogating mHTT-CaM Interaction
Source: 24983
Target: Huntingtin
External Id: KUHTS-Muma KU-CaM-Htt INH-01
|
|
Name: Discovering small molecule activators of G protein-gated inwardly-rectifying potassiu...
Source: 15621
Target: G protein-activated inward rectifier potassium channel 2
External Id: VANDERBILT_HTS_GIRK2_MPD
|
Total 2, Current Page 1 of 1
1
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: InChIKey of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is ZBBCWBZDIXYSBA-UHFFFAOYSA-N. |
| Q: What is the CAS number of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: CAS number of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is 610763-99-0. |
| Q: What is the molecular formula of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: Molecular formula of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is C27H24O7. |
| Q: What is the English name of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: The English name of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one. |
| Q: What is the Chinese name of 610763-99-0? |
| A: Chinese name of 610763-99-0 is 610763-99-0. |
| Q: What is the molecular weight of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: Molecular weight of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is 460.5. |
| Q: What is the SMILES notation of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one? |
| A: SMILES notation of 3-(3,4-dimethoxyphenyl)-7-(2-(4-methoxyphenyl)-2-oxoethoxy)-2-methyl-4H-chromen-4-one is CC1=C(C(=O)C2=C(O1)C=C(C=C2)OCC(=O)C3=CC=C(C=C3)OC)C4=CC(=C(C=C4)OC)OC. |