1-(2-methylbut-3-en-2-yloxy)-2,4-dinitrobenzene structure
|
Common Name | 1-(2-methylbut-3-en-2-yloxy)-2,4-dinitrobenzene | ||
|---|---|---|---|---|
| CAS Number | 61078-09-9 | Molecular Weight | 252.22300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H12N2O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 1-(2-methylbut-3-en-2-yloxy)-2,4-dinitrobenzene |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H12N2O5 |
|---|---|
| Molecular Weight | 252.22300 |
| Exact Mass | 252.07500 |
| PSA | 100.87000 |
| LogP | 3.89280 |
| InChIKey | MGCZEKRIFQOAFA-UHFFFAOYSA-N |
| SMILES | C=CC(C)(C)Oc1ccc([N+](=O)[O-])cc1[N+](=O)[O-] |
|
~%
1-(2-methylbut-... CAS#:61078-09-9 |
| Literature: Astin,K.B.; Whiting,M.C. Journal of the Chemical Society, Perkin Transactions 2: Physical Organic Chemistry (1972-1999), 1976 , p. 1157 - 1160 |
| 1,1-Dimethylallyl-2,4-dinitrophenylether |
| Benzene,1-[(1,1-dimethyl-2-propenyl)oxy]-2,4-dinitro |