N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide structure
|
Common Name | N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide | ||
|---|---|---|---|---|
| CAS Number | 610794-21-3 | Molecular Weight | 333.40900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H19N5O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | N-(3-azidopropyl)-5-(dimethylamino)naphthalene-1-sulfonamide |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H19N5O2S |
|---|---|
| Molecular Weight | 333.40900 |
| Exact Mass | 333.12600 |
| PSA | 107.54000 |
| LogP | 3.80896 |
| InChIKey | SBHUGNBDUYEJFA-UHFFFAOYSA-N |
| SMILES | CN(C)c1cccc2c(S(=O)(=O)NCCCN=[N+]=[N-])cccc12 |
|
~93%
N-(3-azidopropy... CAS#:610794-21-3 |
| Literature: Frei, Reto; Waser, Jeroime Journal of the American Chemical Society, 2013 , vol. 135, # 26 p. 9620 - 9623 |
| N-(3-azidopropyl)-5-(dimethylamino)-1-naphthalenesulfonamide |
| 1-Naphthalenesulfonamide,N-(3-azidopropyl)-5-(dimethylamino) |
| dansyl propyl azide |
| 5-dimethylaminonaphthalene-1-sulfonic acid (3-azidopropyl)amide |
| 3-(dansylamido)propyl azide |
| N-(3-azidopropyl)-dansylamine |
| 5-dimethylnaphthalene-1-sulfonic acid (3-azidopropyl)amide |
| Dansyl azide |