2-[[(2-carboxyphenyl)amino]methylamino]benzoic acid structure
|
Common Name | 2-[[(2-carboxyphenyl)amino]methylamino]benzoic acid | ||
|---|---|---|---|---|
| CAS Number | 61098-02-0 | Molecular Weight | 286.28300 | |
| Density | 1.447g/cm3 | Boiling Point | 602.7ºC at 760 mmHg | |
| Molecular Formula | C15H14N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 318.3ºC | |
| Name | 2-[(2-carboxyanilino)methylamino]benzoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.447g/cm3 |
|---|---|
| Boiling Point | 602.7ºC at 760 mmHg |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.28300 |
| Flash Point | 318.3ºC |
| Exact Mass | 286.09500 |
| PSA | 98.66000 |
| LogP | 2.71050 |
| Index of Refraction | 1.729 |
| InChIKey | PMAPIPPKZXGDFA-UHFFFAOYSA-N |
| SMILES | O=C(O)c1ccccc1NCNc1ccccc1C(=O)O |
|
~93%
2-[[(2-carboxyp... CAS#:61098-02-0 |
| Literature: Errede, L.A.; Ashley, P.E.; McBrady, J.J.; Yarian, D.R. Journal of Organic Chemistry, 1982 , vol. 47, # 20 p. 3825 - 3828 |
| N,N'-methylene-dianthranilic acid |
| N.N'-Methylen-di-anthranilsaeure |
| N,N'-Methandiyl-di-anthranilsaeure |
| N,N'-methanediyl-di-anthranilic acid |