N-[(5-amino-2-octoxyphenyl)methyl]benzamide structure
|
Common Name | N-[(5-amino-2-octoxyphenyl)methyl]benzamide | ||
|---|---|---|---|---|
| CAS Number | 6113-85-5 | Molecular Weight | 354.48600 | |
| Density | 1.066g/cm3 | Boiling Point | 570.8ºC at 760 mmHg | |
| Molecular Formula | C22H30N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 299ºC | |
| Name | N-[(5-amino-2-octoxyphenyl)methyl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.066g/cm3 |
|---|---|
| Boiling Point | 570.8ºC at 760 mmHg |
| Molecular Formula | C22H30N2O2 |
| Molecular Weight | 354.48600 |
| Flash Point | 299ºC |
| Exact Mass | 354.23100 |
| PSA | 67.84000 |
| LogP | 6.09410 |
| Index of Refraction | 1.561 |
| InChIKey | IUPOVWYQIQISOI-UHFFFAOYSA-N |
| SMILES | CCCCCCCCOc1ccc(N)cc1CNC(=O)c1ccccc1 |
|
~%
N-[(5-amino-2-o... CAS#:6113-85-5 |
|
Literature: Collins,R.F.; Davis,M. Journal of the Chemical Society [Section] C: Organic, 1966 , vol. |
| B 6170 |
| 3-Benzoylaminomethyl-4-octyloxy-anilin |