methyl 2-[(2-nitrophenyl)methylideneamino]benzoate structure
|
Common Name | methyl 2-[(2-nitrophenyl)methylideneamino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 61144-88-5 | Molecular Weight | 284.26700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H12N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | methyl 2-[(2-nitrophenyl)methylideneamino]benzoate |
|---|
| Molecular Formula | C15H12N2O4 |
|---|---|
| Molecular Weight | 284.26700 |
| Exact Mass | 284.08000 |
| PSA | 84.48000 |
| LogP | 3.65520 |
| InChIKey | HHRKYCFRLVFDAI-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1N=Cc1ccccc1[N+](=O)[O-] |
|
~%
methyl 2-[(2-ni... CAS#:61144-88-5 |
| Literature: Johnston, David; Smith, David M.; Shepherd, Thomas; Thompson, David Journal of the Chemical Society, Perkin Transactions 1: Organic and Bio-Organic Chemistry (1972-1999), 1987 , p. 495 - 500 |