2-Methyl-3-ethyl-4-oxo-4,5,6,7-tetrahydroindole structure
|
Common Name | 2-Methyl-3-ethyl-4-oxo-4,5,6,7-tetrahydroindole | ||
|---|---|---|---|---|
| CAS Number | 6116-76-3 | Molecular Weight | 177.24300 | |
| Density | 1.106g/cm3 | Boiling Point | 353.8ºC at 760 mmHg | |
| Molecular Formula | C11H15NO | Melting Point | 183℃ | |
| MSDS | N/A | Flash Point | 175.6ºC | |
| Name | 3-ethyl-2-methyl-1,5,6,7-tetrahydroindol-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.106g/cm3 |
|---|---|
| Boiling Point | 353.8ºC at 760 mmHg |
| Melting Point | 183℃ |
| Molecular Formula | C11H15NO |
| Molecular Weight | 177.24300 |
| Flash Point | 175.6ºC |
| Exact Mass | 177.11500 |
| PSA | 32.86000 |
| LogP | 2.40450 |
| Index of Refraction | 1.562 |
| InChIKey | RZUQNFAPFIHYCR-UHFFFAOYSA-N |
| SMILES | CCc1c(C)[nH]c2c1C(=O)CCC2 |
| Storage condition | 2-8℃ |
| HS Code | 2933990090 |
|---|
|
~60%
2-Methyl-3-ethy... CAS#:6116-76-3 |
| Literature: Masaguer, Christian F.; Casariego, Isabel; Ravina, Enrique Chemical and Pharmaceutical Bulletin, 1999 , vol. 47, # 5 p. 621 - 632 |
|
~76%
2-Methyl-3-ethy... CAS#:6116-76-3 |
| Literature: Fukada; Trudell; Johnson; Cook Tetrahedron Letters, 1985 , vol. 26, # 18 p. 2139 - 2142 |
|
~%
2-Methyl-3-ethy... CAS#:6116-76-3 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 16, # 22 p. 5859 - 5863 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3-ethyl-2-methyl-1,5,6,7-tetrahydro-indol-4-one |
| EINECS 228-084-6 |
| 3-ethyl-2-methyl-4,5,6,7-tetrahydroindol-4-one |
| 3-ethyl-2-methyl-4-oxo-1H-4,5,6,7-tetrahydroindole |
| 3-Ethyl-6,7-dihydro-2-methylindol-4(5H)-one |
| 3-Ethyl-2-methyl-4,5,6,7-tetrahydro-indol-4-on |
| 3-ethyl-2-methyl-4-oxo-4,5,6,7-tetrahydroindole |
| 2-methyl-3-ethyl-4-oxo-4,5,6,7-tetrahydroindole |
| 3-ethyl-2-methyl-1,5,6,7-tetrahydro-4h-indol-4-one |