heptyl 4-(dimethylamino)benzenesulfonate structure
|
Common Name | heptyl 4-(dimethylamino)benzenesulfonate | ||
|---|---|---|---|---|
| CAS Number | 61165-53-5 | Molecular Weight | 299.42900 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H25NO3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | heptyl 4-(dimethylamino)benzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C15H25NO3S |
|---|---|
| Molecular Weight | 299.42900 |
| Exact Mass | 299.15600 |
| PSA | 54.99000 |
| LogP | 4.50910 |
| InChIKey | FOZRBKQNKUSPIC-UHFFFAOYSA-N |
| SMILES | CCCCCCCOS(=O)(=O)c1ccc(N(C)C)cc1 |
|
~%
heptyl 4-(dimet... CAS#:61165-53-5 |
| Literature: Sukenik,C.N.; Bergman,R.G. Journal of the American Chemical Society, 1976 , vol. 98, p. 6613 - 6623 |
| n-Heptyl-p-dimethylamino-benzolsulfonat |